What is the Dimethyl 2,3-dichlorosuccinate?

Dimethyl 2,3-dichlorosuccinate is , while it's Molecular Formula is C6H8Cl2O4. Used in Organic Synthesis: Dimethyl 2,3-dichlorosuccinate is used as a reagent in organic synthesis for the preparation of various derivatives. Its ability to undergo substitution reactions with nucleophiles allows for the creation of a variety of products, contributing to the development of new chemical entities. Used in Pharmaceutical Production: In the pharmaceutical industry, Dimethyl 2,3-dichlorosuccinate is employed as a key intermediate in the synthesis of certain drugs. Its reactivity and the ease of forming new compounds make it a useful building block for medicinal chemistry, potentially leading to the discovery of novel therapeutic agents. Used in Chemical Research: Dimethyl 2,3-dichlorosuccinate is utilized in chemical research to explore new reaction pathways and mechanisms. Its unique properties and reactivity provide opportunities for scientists to investigate and understand the behavior of succinate derivatives in various chemical contexts. Safety Considerations: Due to its potential health and environmental impacts, Dimethyl 2,3-dichlorosuccinate is considered a hazardous chemical. It should be handled with care, following appropriate safety protocols to minimize risks to both individuals and the environment.

What is the CAS number for Dimethyl 2,3-dichlorosuccinate?

The CAS number of Dimethyl 2,3-dichlorosuccinate is 62173-55-1.

What is Dimethyl 2,3-dichlorosuccinate (62173-55-1) used for?

Dimethyl 2,3-dichlorosuccinate is a chemical compound with the molecular formula C6H8Cl2O4. It is a derivative of succinic acid, featuring two chlorine atoms attached to the 2 and 3 positions of the succinate molecule. Dimethyl 2,3-dichlorosuccinate is utilized in organic synthesis as a versatile reagent for the preparation of various derivatives, capable of undergoing substitution reactions with nucleophiles to form a range of products. Its applications extend to the production of pharmaceuticals and other organic compounds, making it a valuable component in chemical research and industry.InChI:InChI=1/C6H8Cl2O4/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4H,1-2H3

What is the Dimethyl 2,3-dichlorosuccinate?

Dimethyl 2,3-dichlorosuccinate is , while it's Molecular Formula is C6H8Cl2O4. Used in Organic Synthesis: Dimethyl 2,3-dichlorosuccinate is used as a reagent in organic synthesis for the preparation of various derivatives. Its ability to undergo substitution reactions with nucleophiles allows for the creation of a variety of products, contributing to the development of new chemical entities. Used in Pharmaceutical Production: In the pharmaceutical industry, Dimethyl 2,3-dichlorosuccinate is employed as a key intermediate in the synthesis of certain drugs. Its reactivity and the ease of forming new compounds make it a useful building block for medicinal chemistry, potentially leading to the discovery of novel therapeutic agents. Used in Chemical Research: Dimethyl 2,3-dichlorosuccinate is utilized in chemical research to explore new reaction pathways and mechanisms. Its unique properties and reactivity provide opportunities for scientists to investigate and understand the behavior of succinate derivatives in various chemical contexts. Safety Considerations: Due to its potential health and environmental impacts, Dimethyl 2,3-dichlorosuccinate is considered a hazardous chemical. It should be handled with care, following appropriate safety protocols to minimize risks to both individuals and the environment.

What is the CAS number for Dimethyl 2,3-dichlorosuccinate?

The CAS number of Dimethyl 2,3-dichlorosuccinate is 62173-55-1.

What is Dimethyl 2,3-dichlorosuccinate (62173-55-1) used for?

Dimethyl 2,3-dichlorosuccinate is a chemical compound with the molecular formula C6H8Cl2O4. It is a derivative of succinic acid, featuring two chlorine atoms attached to the 2 and 3 positions of the succinate molecule. Dimethyl 2,3-dichlorosuccinate is utilized in organic synthesis as a versatile reagent for the preparation of various derivatives, capable of undergoing substitution reactions with nucleophiles to form a range of products. Its applications extend to the production of pharmaceuticals and other organic compounds, making it a valuable component in chemical research and industry.InChI:InChI=1/C6H8Cl2O4/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4H,1-2H3

Current location：Home > Products > Dimethyl 2,3-dichlorosuccinate

Dimethyl 2,3-dichlorosuccinate

Name Dimethyl 2,3-dichlorosuccinate
CAS 62173-55-1
Purity 99%

Inquiry

Product Details

Bulk supply high purity Dimethyl 2,3-dichlorosuccinate 62173-55-1, Paid sample available

Molecular Formula: C6H8Cl2O4
Molecular Weight: 215.033
Vapor Pressure: 0.0178mmHg at 25°C
Boiling Point: 253.9°C at 760 mmHg
Flash Point: 105.3°C
PSA： 52.60000
Density: 1.36g/cm³
LogP: 0.54720

Dimethyl 2,3-dichlorosuccinate(Cas 62173-55-1) Usage

General Description

Dimethyl 2,3-dichlorosuccinate is a chemical compound with the molecular formula C6H8Cl2O4. It is a derivative of succinic acid and contains two chlorine atoms attached to the 2 and 3 positions of the succinate molecule. Dimethyl 2,3-dichlorosuccinate is used in organic synthesis as a reagent for the preparation of various derivatives. It can undergo substitution reactions with nucleophiles to form a variety of products, making it useful in the production of pharmaceuticals and other organic compounds. Dimethyl 2,3-dichlorosuccinate is considered to be a hazardous chemical and should be handled with care due to its potential health and environmental impacts.

InChI:InChI=1/C6H8Cl2O4/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4H,1-2H3